About 2-phenylethanedithioic acid;piperidine
2-phenylethanedithioic acid;piperidine (PubChem CID 15744009) has the molecular formula C13H19NS2
and a molecular weight of 253.44 g/mol. Its IUPAC name is 2-phenylethanedithioic acid;piperidine.
Molecular Properties
| Compound Name | 2-phenylethanedithioic acid;piperidine |
| PubChem CID | 15744009 |
| Molecular Formula | C13H19NS2 |
| Molecular Weight | 253.44 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | 2-phenylethanedithioic acid;piperidine |
| SMILES | C1CCNCC1.S=C(S)Cc1ccccc1 |
| InChI | InChI=1S/C8H8S2.C5H11N/c9-8(10)6-7-4-2-1-3-5-7;1-2-4-6-5-3-1/h1-5H,6H2,(H,9,10);6H,1-5H2 |
| InChIKey | RTWKAIJEWPSAOF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethanedithioic acid;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethanedithioic acid;piperidine?
The IUPAC name of 2-phenylethanedithioic acid;piperidine (CID 15744009) is 2-phenylethanedithioic acid;piperidine.
What is the SMILES notation for 2-phenylethanedithioic acid;piperidine?
The canonical SMILES for 2-phenylethanedithioic acid;piperidine is C1CCNCC1.S=C(S)Cc1ccccc1.
What is the InChIKey of 2-phenylethanedithioic acid;piperidine?
The InChIKey is RTWKAIJEWPSAOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8S2.C5H11N/c9-8(10)6-7-4-2-1-3-5-7;1-2-4-6-5-3-1/h1-5H,6H2,(H,9,10);6H,1-5H2.
What are the key properties of 2-phenylethanedithioic acid;piperidine?
2-phenylethanedithioic acid;piperidine has a molecular weight of 253.44 g/mol, XLogP of 3.25, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethanedithioic acid;piperidine is sourced from PubChem (CID 15744009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).