About azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene
azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene (PubChem CID 162357982) has the molecular formula C18H27N
and a molecular weight of 257.42 g/mol. Its IUPAC name is azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene.
Molecular Properties
| Compound Name | azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene |
| PubChem CID | 162357982 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene |
| SMILES | C=C/C=C\C(=C)CC(=C)C.CCc1ccccc1.N |
| InChI | InChI=1S/C10H14.C8H10.H3N/c1-5-6-7-10(4)8-9(2)3;1-2-8-6-4-3-5-7-8;/h5-7H,1-2,4,8H2,3H3;3-7H,2H2,1H3;1H3/b7-6-;; |
| InChIKey | NPHWGPCAZMJAIN-AQTVDGORSA-N |
| XLogP | 5.66 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene?
The IUPAC name of azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene (CID 162357982) is azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene.
What is the SMILES notation for azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene?
The canonical SMILES for azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene is C=C/C=C\C(=C)CC(=C)C.CCc1ccccc1.N.
What is the InChIKey of azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene?
The InChIKey is NPHWGPCAZMJAIN-AQTVDGORSA-N. The full InChI is InChI=1S/C10H14.C8H10.H3N/c1-5-6-7-10(4)8-9(2)3;1-2-8-6-4-3-5-7-8;/h5-7H,1-2,4,8H2,3H3;3-7H,2H2,1H3;1H3/b7-6-;;.
What are the key properties of azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene?
azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene has a molecular weight of 257.42 g/mol, XLogP of 5.66, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene is sourced from PubChem (CID 162357982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).