C18H27N — CID 162357982
azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene (PubChem CID 162357982) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene.
| Compound Name | azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene |
|---|---|
| PubChem CID | 162357982 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | azane;ethylbenzene;(3Z)-7-methyl-5-methylideneocta-1,3,7-triene |
| SMILES | C=C/C=C\C(=C)CC(=C)C.CCc1ccccc1.N |
| InChI | InChI=1S/C10H14.C8H10.H3N/c1-5-6-7-10(4)8-9(2)3;1-2-8-6-4-3-5-7-8;/h5-7H,1-2,4,8H2,3H3;3-7H,2H2,1H3;1H3/b7-6-;; |
| InChIKey | NPHWGPCAZMJAIN-AQTVDGORSA-N |
| XLogP | 5.66 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|