C13H16 — CID 143096583
(3Z,8Z)-5,7-dimethylideneundeca-1,3,8,10-tetraene (PubChem CID 143096583) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is (3Z,8Z)-5,7-dimethylideneundeca-1,3,8,10-tetraene.
| Compound Name | (3Z,8Z)-5,7-dimethylideneundeca-1,3,8,10-tetraene |
|---|---|
| PubChem CID | 143096583 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | (3Z,8Z)-5,7-dimethylideneundeca-1,3,8,10-tetraene |
| SMILES | C=C/C=C\C(=C)CC(=C)/C=C\C=C |
| InChI | InChI=1S/C13H16/c1-5-7-9-12(3)11-13(4)10-8-6-2/h5-10H,1-4,11H2/b9-7-,10-8- |
| InChIKey | WJWBSDUAOVIYTM-XOHWUJONSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|