C11H14FN — CID 170748662
(3Z)-N-[(3E)-4-fluorobuta-1,3-dien-2-yl]-2-methylidenehexa-3,5-dien-1-amine (PubChem CID 170748662) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is (3Z)-N-[(3E)-4-fluorobuta-1,3-dien-2-yl]-2-methylidenehexa-3,5-dien-1-amine.
| Compound Name | (3Z)-N-[(3E)-4-fluorobuta-1,3-dien-2-yl]-2-methylidenehexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 170748662 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (3Z)-N-[(3E)-4-fluorobuta-1,3-dien-2-yl]-2-methylidenehexa-3,5-dien-1-amine |
| SMILES | C=C/C=C\C(=C)CNC(=C)/C=C/F |
| InChI | InChI=1S/C11H14FN/c1-4-5-6-10(2)9-13-11(3)7-8-12/h4-8,13H,1-3,9H2/b6-5-,8-7+ |
| InChIKey | VCUXCQXUINPFHE-IGTJQSIKSA-N |
| XLogP | 2.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|