C7H12N2 — CID 143800982
[(3Z)-2-methylidenehexa-3,5-dienyl]hydrazine (PubChem CID 143800982) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is [(3Z)-2-methylidenehexa-3,5-dienyl]hydrazine.
| Compound Name | [(3Z)-2-methylidenehexa-3,5-dienyl]hydrazine |
|---|---|
| PubChem CID | 143800982 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | [(3Z)-2-methylidenehexa-3,5-dienyl]hydrazine |
| SMILES | C=C/C=C\C(=C)CNN |
| InChI | InChI=1S/C7H12N2/c1-3-4-5-7(2)6-9-8/h3-5,9H,1-2,6,8H2/b5-4- |
| InChIKey | GOFZVWPTMHPIHB-PLNGDYQASA-N |
| XLogP | 0.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|