C10H18O — CID 143500367
ethane;(3Z)-2-(methoxymethyl)hexa-1,3,5-triene (PubChem CID 143500367) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is ethane;(3Z)-2-(methoxymethyl)hexa-1,3,5-triene.
| Compound Name | ethane;(3Z)-2-(methoxymethyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 143500367 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | ethane;(3Z)-2-(methoxymethyl)hexa-1,3,5-triene |
| SMILES | C=C/C=C\C(=C)COC.CC |
| InChI | InChI=1S/C8H12O.C2H6/c1-4-5-6-8(2)7-9-3;1-2/h4-6H,1-2,7H2,3H3;1-2H3/b6-5-; |
| InChIKey | CTKOLPLBLGHTSA-YSMBQZINSA-N |
| XLogP | 2.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|