C12H22N2O2 — CID 143852842
ethane;methyl N-amino-N-[(4Z)-3-methylidenehepta-4,6-dienyl]carbamate (PubChem CID 143852842) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is ethane;methyl N-amino-N-[(4Z)-3-methylidenehepta-4,6-dienyl]carbamate.
| Compound Name | ethane;methyl N-amino-N-[(4Z)-3-methylidenehepta-4,6-dienyl]carbamate |
|---|---|
| PubChem CID | 143852842 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | ethane;methyl N-amino-N-[(4Z)-3-methylidenehepta-4,6-dienyl]carbamate |
| SMILES | C=C/C=C\C(=C)CCN(N)C(=O)OC.CC |
| InChI | InChI=1S/C10H16N2O2.C2H6/c1-4-5-6-9(2)7-8-12(11)10(13)14-3;1-2/h4-6H,1-2,7-8,11H2,3H3;1-2H3/b6-5-; |
| InChIKey | NESIZQKEBBMKPW-YSMBQZINSA-N |
| XLogP | 2.64 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|