About [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate
[(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate (PubChem CID 134297685) has the molecular formula C13H20N2O3
and a molecular weight of 252.31 g/mol. Its IUPAC name is [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate.
Molecular Properties
| Compound Name | [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate |
| PubChem CID | 134297685 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate |
| SMILES | C=C/C=C\C(=C)COC(=O)NCCC(=O)N(C)C |
| InChI | InChI=1S/C13H20N2O3/c1-5-6-7-11(2)10-18-13(17)14-9-8-12(16)15(3)4/h5-7H,1-2,8-10H2,3-4H3,(H,14,17)/b7-6- |
| InChIKey | AHTSEUPAEWNGHB-SREVYHEPSA-N |
| XLogP | 1.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate?
The IUPAC name of [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate (CID 134297685) is [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate.
What is the SMILES notation for [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate?
The canonical SMILES for [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate is C=C/C=C\C(=C)COC(=O)NCCC(=O)N(C)C.
What is the InChIKey of [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate?
The InChIKey is AHTSEUPAEWNGHB-SREVYHEPSA-N. The full InChI is InChI=1S/C13H20N2O3/c1-5-6-7-11(2)10-18-13(17)14-9-8-12(16)15(3)4/h5-7H,1-2,8-10H2,3-4H3,(H,14,17)/b7-6-.
What are the key properties of [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate?
[(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate has a molecular weight of 252.31 g/mol, XLogP of 1.49, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate is sourced from PubChem (CID 134297685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).