C13H20N2O3 — CID 134297685
[(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate (PubChem CID 134297685) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate.
| Compound Name | [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 134297685 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | [(3Z)-2-methylidenehexa-3,5-dienyl] N-[3-(dimethylamino)-3-oxopropyl]carbamate |
| SMILES | C=C/C=C\C(=C)COC(=O)NCCC(=O)N(C)C |
| InChI | InChI=1S/C13H20N2O3/c1-5-6-7-11(2)10-18-13(17)14-9-8-12(16)15(3)4/h5-7H,1-2,8-10H2,3-4H3,(H,14,17)/b7-6- |
| InChIKey | AHTSEUPAEWNGHB-SREVYHEPSA-N |
| XLogP | 1.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|