C23H41NO3 — CID 142368602
ethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropan-1-ol;(5Z)-N-methyl-4-methylideneocta-5,7-dienamide (PubChem CID 142368602) has the molecular formula C23H41NO3 and a molecular weight of 379.59 g/mol. Its IUPAC name is ethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropan-1-ol;(5Z)-N-methyl-4-methylideneocta-5,7-dienamide.
| Compound Name | ethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropan-1-ol;(5Z)-N-methyl-4-methylideneocta-5,7-dienamide |
|---|---|
| PubChem CID | 142368602 |
| Molecular Formula | C23H41NO3 |
| Molecular Weight | 379.59 g/mol |
| Exact Mass | 379.31 |
| IUPAC Name | ethane;3-[(3Z)-hexa-1,3,5-trien-2-yl]oxypropan-1-ol;(5Z)-N-methyl-4-methylideneocta-5,7-dienamide |
| SMILES | C=C/C=C\C(=C)CCC(=O)NC.C=C/C=C\C(=C)OCCCO.CC.CC |
| InChI | InChI=1S/C10H15NO.C9H14O2.2C2H6/c1-4-5-6-9(2)7-8-10(12)11-3;1-3-4-6-9(2)11-8-5-7-10;2*1-2/h4-6H,1-2,7-8H2,3H3,(H,11,12);3-4,6,10H,1-2,5,7-8H2;2*1-2H3/b6-5-;6-4-;; |
| InChIKey | LVTXGEIEJVCNAD-FFFZRMHJSA-N |
| XLogP | 5.50 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|