C18H41N3O5 — CID 158050690
8-hydroxy-N-methyloctanamide;methane;N-methyl-3-[2-(methylamino)-2-oxoethoxy]propanamide (PubChem CID 158050690) has the molecular formula C18H41N3O5 and a molecular weight of 379.54 g/mol. Its IUPAC name is 8-hydroxy-N-methyloctanamide;methane;N-methyl-3-[2-(methylamino)-2-oxoethoxy]propanamide.
| Compound Name | 8-hydroxy-N-methyloctanamide;methane;N-methyl-3-[2-(methylamino)-2-oxoethoxy]propanamide |
|---|---|
| PubChem CID | 158050690 |
| Molecular Formula | C18H41N3O5 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.30 |
| IUPAC Name | 8-hydroxy-N-methyloctanamide;methane;N-methyl-3-[2-(methylamino)-2-oxoethoxy]propanamide |
| SMILES | C.C.CNC(=O)CCCCCCCO.CNC(=O)CCOCC(=O)NC |
| InChI | InChI=1S/C9H19NO2.C7H14N2O3.2CH4/c1-10-9(12)7-5-3-2-4-6-8-11;1-8-6(10)3-4-12-5-7(11)9-2;;/h11H,2-8H2,1H3,(H,10,12);3-5H2,1-2H3,(H,8,10)(H,9,11);2*1H4 |
| InChIKey | FJLFNLZGBMHJNA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|