C13H20O — CID 89174418
[(3Z)-2-methylidenehexa-3,5-dienoxy]cyclohexane (PubChem CID 89174418) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is [(3Z)-2-methylidenehexa-3,5-dienoxy]cyclohexane.
| Compound Name | [(3Z)-2-methylidenehexa-3,5-dienoxy]cyclohexane |
|---|---|
| PubChem CID | 89174418 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | [(3Z)-2-methylidenehexa-3,5-dienoxy]cyclohexane |
| SMILES | C=C/C=C\C(=C)COC1CCCCC1 |
| InChI | InChI=1S/C13H20O/c1-3-4-8-12(2)11-14-13-9-6-5-7-10-13/h3-4,8,13H,1-2,5-7,9-11H2/b8-4- |
| InChIKey | FKXGMHDZYUMGNM-YWEYNIOJSA-N |
| XLogP | 3.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|