C14H22O2 — CID 154973670
1-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxycyclohexane (PubChem CID 154973670) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxycyclohexane.
| Compound Name | 1-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxycyclohexane |
|---|---|
| PubChem CID | 154973670 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-[(3Z)-hexa-1,3,5-trien-2-yl]oxyethoxycyclohexane |
| SMILES | C=C/C=C\C(=C)OC(C)OC1CCCCC1 |
| InChI | InChI=1S/C14H22O2/c1-4-5-9-12(2)15-13(3)16-14-10-7-6-8-11-14/h4-5,9,13-14H,1-2,6-8,10-11H2,3H3/b9-5- |
| InChIKey | OIIPWWKTJSIXDJ-UITAMQMPSA-N |
| XLogP | 3.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|