C19H32O3Si — CID 141377464
buta-1,3-dienyl(tricyclopentyloxy)silane (PubChem CID 141377464) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is buta-1,3-dienyl(tricyclopentyloxy)silane.
| Compound Name | buta-1,3-dienyl(tricyclopentyloxy)silane |
|---|---|
| PubChem CID | 141377464 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | buta-1,3-dienyl(tricyclopentyloxy)silane |
| SMILES | C=CC=C[Si](OC1CCCC1)(OC1CCCC1)OC1CCCC1 |
| InChI | InChI=1S/C19H32O3Si/c1-2-3-16-23(20-17-10-4-5-11-17,21-18-12-6-7-13-18)22-19-14-8-9-15-19/h2-3,16-19H,1,4-15H2 |
| InChIKey | QBUQIBZPSBTJEC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|