C13H26 — CID 142806939
methane;(3Z)-5-methylidenedeca-1,3-diene (PubChem CID 142806939) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is methane;(3Z)-5-methylidenedeca-1,3-diene.
| Compound Name | methane;(3Z)-5-methylidenedeca-1,3-diene |
|---|---|
| PubChem CID | 142806939 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | methane;(3Z)-5-methylidenedeca-1,3-diene |
| SMILES | C.C.C=C/C=C\C(=C)CCCCC |
| InChI | InChI=1S/C11H18.2CH4/c1-4-6-8-10-11(3)9-7-5-2;;/h5,7,9H,2-4,6,8,10H2,1H3;2*1H4/b9-7-;; |
| InChIKey | FIXYAKKLIYAKCL-COUYFGMESA-N |
| XLogP | 5.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|