C11H21NO — CID 144959851
2-methoxy-N-methylethanamine;(3Z)-2-methylhexa-1,3,5-triene (PubChem CID 144959851) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 2-methoxy-N-methylethanamine;(3Z)-2-methylhexa-1,3,5-triene.
| Compound Name | 2-methoxy-N-methylethanamine;(3Z)-2-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 144959851 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2-methoxy-N-methylethanamine;(3Z)-2-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C\C(=C)C.CNCCOC |
| InChI | InChI=1S/C7H10.C4H11NO/c1-4-5-6-7(2)3;1-5-3-4-6-2/h4-6H,1-2H2,3H3;5H,3-4H2,1-2H3/b6-5-; |
| InChIKey | PVQJYCJISWUTQG-YSMBQZINSA-N |
| XLogP | 2.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|