C18H21N — CID 145447757
(3Z,7Z)-N-benzyl-6-methylidenedeca-3,7,9-trien-1-imine (PubChem CID 145447757) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is (3Z,7Z)-N-benzyl-6-methylidenedeca-3,7,9-trien-1-imine.
| Compound Name | (3Z,7Z)-N-benzyl-6-methylidenedeca-3,7,9-trien-1-imine |
|---|---|
| PubChem CID | 145447757 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | (3Z,7Z)-N-benzyl-6-methylidenedeca-3,7,9-trien-1-imine |
| SMILES | C=C/C=C\C(=C)C/C=C\C/C=N/Cc1ccccc1 |
| InChI | InChI=1S/C18H21N/c1-3-4-11-17(2)12-7-6-10-15-19-16-18-13-8-5-9-14-18/h3-9,11,13-15H,1-2,10,12,16H2/b7-6-,11-4-,19-15+ |
| InChIKey | XLLLCDIETCMXLD-NKUDHOAYSA-N |
| XLogP | 4.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|