C23H35N — CID 171081806
N-benzyl-2,2,4,4-tetramethyl-N-[(3Z)-2-methylidenehexa-3,5-dienyl]pentan-1-amine (PubChem CID 171081806) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is N-benzyl-2,2,4,4-tetramethyl-N-[(3Z)-2-methylidenehexa-3,5-dienyl]pentan-1-amine.
| Compound Name | N-benzyl-2,2,4,4-tetramethyl-N-[(3Z)-2-methylidenehexa-3,5-dienyl]pentan-1-amine |
|---|---|
| PubChem CID | 171081806 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | N-benzyl-2,2,4,4-tetramethyl-N-[(3Z)-2-methylidenehexa-3,5-dienyl]pentan-1-amine |
| SMILES | C=C/C=C\C(=C)CN(Cc1ccccc1)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C23H35N/c1-8-9-13-20(2)16-24(17-21-14-11-10-12-15-21)19-23(6,7)18-22(3,4)5/h8-15H,1-2,16-19H2,3-7H3/b13-9- |
| InChIKey | LHFPHUVUARKESJ-LCYFTJDESA-N |
| XLogP | 6.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|