C14H17N — CID 167283713
(1Z,3Z)-N-benzyl-N-methylhexa-1,3,5-trien-1-amine (PubChem CID 167283713) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is (1Z,3Z)-N-benzyl-N-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-N-benzyl-N-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 167283713 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (1Z,3Z)-N-benzyl-N-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C\C=C/N(C)Cc1ccccc1 |
| InChI | InChI=1S/C14H17N/c1-3-4-5-9-12-15(2)13-14-10-7-6-8-11-14/h3-12H,1,13H2,2H3/b5-4-,12-9- |
| InChIKey | RLRHQRZVPJLVQG-XJJAZQAQSA-N |
| XLogP | 3.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|