C18H19NO3 — CID 175740465
4-[benzyl(methyl)amino]-4-prop-2-enoylhepta-1,6-diene-3,5-dione (PubChem CID 175740465) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 4-[benzyl(methyl)amino]-4-prop-2-enoylhepta-1,6-diene-3,5-dione.
| Compound Name | 4-[benzyl(methyl)amino]-4-prop-2-enoylhepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 175740465 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 4-[benzyl(methyl)amino]-4-prop-2-enoylhepta-1,6-diene-3,5-dione |
| SMILES | C=CC(=O)C(C(=O)C=C)(C(=O)C=C)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-5-15(20)18(16(21)6-2,17(22)7-3)19(4)13-14-11-9-8-10-12-14/h5-12H,1-3,13H2,4H3 |
| InChIKey | OLGGVQSZEJABIM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|