C13H16F3NO6 — CID 44889676
N-benzyl-1,1,1-trifluoro-N-methylmethanamine;2,3-dihydroxybutanedioic acid (PubChem CID 44889676) has the molecular formula C13H16F3NO6 and a molecular weight of 339.27 g/mol. Its IUPAC name is N-benzyl-1,1,1-trifluoro-N-methylmethanamine;2,3-dihydroxybutanedioic acid.
| Compound Name | N-benzyl-1,1,1-trifluoro-N-methylmethanamine;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 44889676 |
| Molecular Formula | C13H16F3NO6 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-benzyl-1,1,1-trifluoro-N-methylmethanamine;2,3-dihydroxybutanedioic acid |
| SMILES | CN(Cc1ccccc1)C(F)(F)F.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C9H10F3N.C4H6O6/c1-13(9(10,11)12)7-8-5-3-2-4-6-8;5-1(3(7)8)2(6)4(9)10/h2-6H,7H2,1H3;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | BMXCAYJSLQNOGO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|