C13H15BrF3NO2 — CID 11291164
N-benzyl-N-[(2R,3R)-4-bromo-1,1,1-trifluoro-3-hydroxybutan-2-yl]acetamide (PubChem CID 11291164) has the molecular formula C13H15BrF3NO2 and a molecular weight of 354.17 g/mol. Its IUPAC name is N-benzyl-N-[(2R,3R)-4-bromo-1,1,1-trifluoro-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-benzyl-N-[(2R,3R)-4-bromo-1,1,1-trifluoro-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 11291164 |
| Molecular Formula | C13H15BrF3NO2 |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 353.02 |
| IUPAC Name | N-benzyl-N-[(2R,3R)-4-bromo-1,1,1-trifluoro-3-hydroxybutan-2-yl]acetamide |
| SMILES | CC(=O)N(Cc1ccccc1)[C@H]([C@@H](O)CBr)C(F)(F)F |
| InChI | InChI=1S/C13H15BrF3NO2/c1-9(19)18(8-10-5-3-2-4-6-10)12(11(20)7-14)13(15,16)17/h2-6,11-12,20H,7-8H2,1H3/t11-,12+/m0/s1 |
| InChIKey | OKDIGVYGXDKKPF-NWDGAFQWSA-N |
| XLogP | 2.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|