C10H16N2 — CID 23468062
1-benzyl-1,2,2-trimethylhydrazine (PubChem CID 23468062) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-benzyl-1,2,2-trimethylhydrazine.
| Compound Name | 1-benzyl-1,2,2-trimethylhydrazine |
|---|---|
| PubChem CID | 23468062 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1-benzyl-1,2,2-trimethylhydrazine |
| SMILES | CN(C)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C10H16N2/c1-11(2)12(3)9-10-7-5-4-6-8-10/h4-8H,9H2,1-3H3 |
| InChIKey | RZMUHBFEJHQHGM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|