C19H23N — CID 78088479
N,N-dibenzyl-2-methylbut-2-en-1-amine (PubChem CID 78088479) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is N,N-dibenzyl-2-methylbut-2-en-1-amine.
| Compound Name | N,N-dibenzyl-2-methylbut-2-en-1-amine |
|---|---|
| PubChem CID | 78088479 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N,N-dibenzyl-2-methylbut-2-en-1-amine |
| SMILES | CC=C(C)CN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H23N/c1-3-17(2)14-20(15-18-10-6-4-7-11-18)16-19-12-8-5-9-13-19/h3-13H,14-16H2,1-2H3 |
| InChIKey | DQDHELJRYJEPHP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|