C20H26N2O2S2 — CID 143852645
4-[[[(E)-2-methylbut-2-enyl]-(2-phenylsulfanylethyl)amino]methyl]benzenesulfonamide (PubChem CID 143852645) has the molecular formula C20H26N2O2S2 and a molecular weight of 390.57 g/mol. Its IUPAC name is 4-[[[(E)-2-methylbut-2-enyl]-(2-phenylsulfanylethyl)amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[(E)-2-methylbut-2-enyl]-(2-phenylsulfanylethyl)amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 143852645 |
| Molecular Formula | C20H26N2O2S2 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-[[[(E)-2-methylbut-2-enyl]-(2-phenylsulfanylethyl)amino]methyl]benzenesulfonamide |
| SMILES | C/C=C(\C)CN(CCSc1ccccc1)Cc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H26N2O2S2/c1-3-17(2)15-22(13-14-25-19-7-5-4-6-8-19)16-18-9-11-20(12-10-18)26(21,23)24/h3-12H,13-16H2,1-2H3,(H2,21,23,24)/b17-3+ |
| InChIKey | NOFAPPJBKDEAKB-IJUHEHPCSA-N |
| XLogP | 3.89 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|