C19H24N2O4S — CID 25061599
3-[benzyl(ethyl)amino]propyl 4-sulfamoylbenzoate (PubChem CID 25061599) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is 3-[benzyl(ethyl)amino]propyl 4-sulfamoylbenzoate.
| Compound Name | 3-[benzyl(ethyl)amino]propyl 4-sulfamoylbenzoate |
|---|---|
| PubChem CID | 25061599 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-[benzyl(ethyl)amino]propyl 4-sulfamoylbenzoate |
| SMILES | CCN(CCCOC(=O)c1ccc(S(N)(=O)=O)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-2-21(15-16-7-4-3-5-8-16)13-6-14-25-19(22)17-9-11-18(12-10-17)26(20,23)24/h3-5,7-12H,2,6,13-15H2,1H3,(H2,20,23,24) |
| InChIKey | LVAZLFWXILZTJD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|