C22H22N6O4S3 — CID 140615951
[4-[[(4-azidosulfonylphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylazaniumylideneazanide (PubChem CID 140615951) has the molecular formula C22H22N6O4S3 and a molecular weight of 530.66 g/mol. Its IUPAC name is [4-[[(4-azidosulfonylphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylazaniumylideneazanide.
| Compound Name | [4-[[(4-azidosulfonylphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylazaniumylideneazanide |
|---|---|
| PubChem CID | 140615951 |
| Molecular Formula | C22H22N6O4S3 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | [4-[[(4-azidosulfonylphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylazaniumylideneazanide |
| SMILES | [N-]=[N+]=NS(=O)(=O)c1ccc(CN(CCSc2ccccc2)Cc2ccc(S(=O)(=O)[NH+]=[N-])cc2)cc1 |
| InChI | InChI=1S/C22H22N6O4S3/c23-25-27-35(31,32)22-12-8-19(9-13-22)17-28(14-15-33-20-4-2-1-3-5-20)16-18-6-10-21(11-7-18)34(29,30)26-24/h1-13,26H,14-17H2 |
| InChIKey | YIWJKQFWIDHHFG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|