C29H26FN3O5S2 — CID 56656492
N-[4-[[(4-fluoro-3-nitrophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylbenzamide (PubChem CID 56656492) has the molecular formula C29H26FN3O5S2 and a molecular weight of 579.68 g/mol. Its IUPAC name is N-[4-[[(4-fluoro-3-nitrophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylbenzamide.
| Compound Name | N-[4-[[(4-fluoro-3-nitrophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 56656492 |
| Molecular Formula | C29H26FN3O5S2 |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | N-[4-[[(4-fluoro-3-nitrophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(CN(CCSc2ccccc2)Cc2ccc(F)c([N+](=O)[O-])c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H26FN3O5S2/c30-27-16-13-23(19-28(27)33(35)36)21-32(17-18-39-25-9-5-2-6-10-25)20-22-11-14-26(15-12-22)40(37,38)31-29(34)24-7-3-1-4-8-24/h1-16,19H,17-18,20-21H2,(H,31,34) |
| InChIKey | ATMXUUOOVUBGGH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|