C29H26ClFN2OS2 — CID 146324790
N-[4-[[(2-chloro-6-fluorophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfanylbenzamide (PubChem CID 146324790) has the molecular formula C29H26ClFN2OS2 and a molecular weight of 537.13 g/mol. Its IUPAC name is N-[4-[[(2-chloro-6-fluorophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfanylbenzamide.
| Compound Name | N-[4-[[(2-chloro-6-fluorophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 146324790 |
| Molecular Formula | C29H26ClFN2OS2 |
| Molecular Weight | 537.13 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | N-[4-[[(2-chloro-6-fluorophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfanylbenzamide |
| SMILES | O=C(NSc1ccc(CN(CCSc2ccccc2)Cc2c(F)cccc2Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H26ClFN2OS2/c30-27-12-7-13-28(31)26(27)21-33(18-19-35-24-10-5-2-6-11-24)20-22-14-16-25(17-15-22)36-32-29(34)23-8-3-1-4-9-23/h1-17H,18-21H2,(H,32,34) |
| InChIKey | SKVMQVPGDXDHJL-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.13 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|