C43H37F4N3O6S2 — CID 121298466
4-[3,4-bis(2,4-difluorophenyl)-2,5-dioxopyrrol-1-yl]-N-[4-[[(3-methoxyphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylbutanamide (PubChem CID 121298466) has the molecular formula C43H37F4N3O6S2 and a molecular weight of 831.91 g/mol. Its IUPAC name is 4-[3,4-bis(2,4-difluorophenyl)-2,5-dioxopyrrol-1-yl]-N-[4-[[(3-methoxyphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylbutanamide.
| Compound Name | 4-[3,4-bis(2,4-difluorophenyl)-2,5-dioxopyrrol-1-yl]-N-[4-[[(3-methoxyphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylbutanamide |
|---|---|
| PubChem CID | 121298466 |
| Molecular Formula | C43H37F4N3O6S2 |
| Molecular Weight | 831.91 g/mol |
| Exact Mass | 831.21 |
| IUPAC Name | 4-[3,4-bis(2,4-difluorophenyl)-2,5-dioxopyrrol-1-yl]-N-[4-[[(3-methoxyphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonylbutanamide |
| SMILES | COc1cccc(CN(CCSc2ccccc2)Cc2ccc(S(=O)(=O)NC(=O)CCCN3C(=O)C(c4ccc(F)cc4F)=C(c4ccc(F)cc4F)C3=O)cc2)c1 |
| InChI | InChI=1S/C43H37F4N3O6S2/c1-56-32-8-5-7-29(23-32)27-49(21-22-57-33-9-3-2-4-10-33)26-28-12-16-34(17-13-28)58(54,55)48-39(51)11-6-20-50-42(52)40(35-18-14-30(44)24-37(35)46)41(43(50)53)36-19-15-31(45)25-38(36)47/h2-5,7-10,12-19,23-25H,6,11,20-22,26-27H2,1H3,(H,48,51) |
| InChIKey | XDTLNUXSBFVMMV-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.91 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|