C31H29F3N2O3S2 — CID 146324742
N-[4-[[(3-methoxyphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfanyl-4-(trifluoromethoxy)benzamide (PubChem CID 146324742) has the molecular formula C31H29F3N2O3S2 and a molecular weight of 598.71 g/mol. Its IUPAC name is N-[4-[[(3-methoxyphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfanyl-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[4-[[(3-methoxyphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfanyl-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 146324742 |
| Molecular Formula | C31H29F3N2O3S2 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | N-[4-[[(3-methoxyphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfanyl-4-(trifluoromethoxy)benzamide |
| SMILES | COc1cccc(CN(CCSc2ccccc2)Cc2ccc(SNC(=O)c3ccc(OC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C31H29F3N2O3S2/c1-38-27-7-5-6-24(20-27)22-36(18-19-40-28-8-3-2-4-9-28)21-23-10-16-29(17-11-23)41-35-30(37)25-12-14-26(15-13-25)39-31(32,33)34/h2-17,20H,18-19,21-22H2,1H3,(H,35,37) |
| InChIKey | NLMASRMLZVDKQX-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|