C26H30N2O2S — CID 43909345
N-[4-(diethylaminomethyl)phenyl]-4-(2-phenylsulfanylethoxy)benzamide (PubChem CID 43909345) has the molecular formula C26H30N2O2S and a molecular weight of 434.61 g/mol. Its IUPAC name is N-[4-(diethylaminomethyl)phenyl]-4-(2-phenylsulfanylethoxy)benzamide.
| Compound Name | N-[4-(diethylaminomethyl)phenyl]-4-(2-phenylsulfanylethoxy)benzamide |
|---|---|
| PubChem CID | 43909345 |
| Molecular Formula | C26H30N2O2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[4-(diethylaminomethyl)phenyl]-4-(2-phenylsulfanylethoxy)benzamide |
| SMILES | CCN(CC)Cc1ccc(NC(=O)c2ccc(OCCSc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H30N2O2S/c1-3-28(4-2)20-21-10-14-23(15-11-21)27-26(29)22-12-16-24(17-13-22)30-18-19-31-25-8-6-5-7-9-25/h5-17H,3-4,18-20H2,1-2H3,(H,27,29) |
| InChIKey | ACFNERWKAXEISO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|