C19H23NO2S — CID 92686107
N,N-diethyl-4-(2-phenylsulfanylethoxy)benzamide (PubChem CID 92686107) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is N,N-diethyl-4-(2-phenylsulfanylethoxy)benzamide.
| Compound Name | N,N-diethyl-4-(2-phenylsulfanylethoxy)benzamide |
|---|---|
| PubChem CID | 92686107 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N,N-diethyl-4-(2-phenylsulfanylethoxy)benzamide |
| SMILES | CCN(CC)C(=O)c1ccc(OCCSc2ccccc2)cc1 |
| InChI | InChI=1S/C19H23NO2S/c1-3-20(4-2)19(21)16-10-12-17(13-11-16)22-14-15-23-18-8-6-5-7-9-18/h5-13H,3-4,14-15H2,1-2H3 |
| InChIKey | XHOCSGJRRYIFAO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|