C34H30N6O5S3 — CID 121298532
N-[4-[[(4-azidosulfonylphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonyl-4-pyridin-2-ylbenzamide (PubChem CID 121298532) has the molecular formula C34H30N6O5S3 and a molecular weight of 698.85 g/mol. Its IUPAC name is N-[4-[[(4-azidosulfonylphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonyl-4-pyridin-2-ylbenzamide.
| Compound Name | N-[4-[[(4-azidosulfonylphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonyl-4-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 121298532 |
| Molecular Formula | C34H30N6O5S3 |
| Molecular Weight | 698.85 g/mol |
| Exact Mass | 698.14 |
| IUPAC Name | N-[4-[[(4-azidosulfonylphenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonyl-4-pyridin-2-ylbenzamide |
| SMILES | [N-]=[N+]=NS(=O)(=O)c1ccc(CN(CCSc2ccccc2)Cc2ccc(S(=O)(=O)NC(=O)c3ccc(-c4ccccn4)cc3)cc2)cc1 |
| InChI | InChI=1S/C34H30N6O5S3/c35-38-39-48(44,45)32-19-11-27(12-20-32)25-40(22-23-46-30-6-2-1-3-7-30)24-26-9-17-31(18-10-26)47(42,43)37-34(41)29-15-13-28(14-16-29)33-8-4-5-21-36-33/h1-21H,22-25H2,(H,37,41) |
| InChIKey | GCVHNYPZNKTVCA-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 162.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.85 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|