C21H19N3O4S2 — CID 88935008
N-[3-nitroso-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 88935008) has the molecular formula C21H19N3O4S2 and a molecular weight of 441.53 g/mol. Its IUPAC name is N-[3-nitroso-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | N-[3-nitroso-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 88935008 |
| Molecular Formula | C21H19N3O4S2 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-[3-nitroso-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | O=Nc1cc(S(=O)(=O)NC(=O)c2ccccc2)ccc1NCCSc1ccccc1 |
| InChI | InChI=1S/C21H19N3O4S2/c25-21(16-7-3-1-4-8-16)24-30(27,28)18-11-12-19(20(15-18)23-26)22-13-14-29-17-9-5-2-6-10-17/h1-12,15,22H,13-14H2,(H,24,25) |
| InChIKey | YZYARVLTYXPQIO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|