C23H25N7O4S2 — CID 171442939
N-[3-nitroso-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-6-piperazin-1-ylpyridazine-3-carboxamide (PubChem CID 171442939) has the molecular formula C23H25N7O4S2 and a molecular weight of 527.63 g/mol. Its IUPAC name is N-[3-nitroso-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-6-piperazin-1-ylpyridazine-3-carboxamide.
| Compound Name | N-[3-nitroso-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-6-piperazin-1-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 171442939 |
| Molecular Formula | C23H25N7O4S2 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | N-[3-nitroso-4-(2-phenylsulfanylethylamino)phenyl]sulfonyl-6-piperazin-1-ylpyridazine-3-carboxamide |
| SMILES | O=Nc1cc(S(=O)(=O)NC(=O)c2ccc(N3CCNCC3)nn2)ccc1NCCSc1ccccc1 |
| InChI | InChI=1S/C23H25N7O4S2/c31-23(20-8-9-22(27-26-20)30-13-10-24-11-14-30)29-36(33,34)18-6-7-19(21(16-18)28-32)25-12-15-35-17-4-2-1-3-5-17/h1-9,16,24-25H,10-15H2,(H,29,31) |
| InChIKey | KWJYPSWSUPFVDS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 145.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|