C35H34N8O7S3 — CID 169272336
6-[4-[4-(5-ethoxy-3-pyridinyl)thiophene-2-carbonyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide (PubChem CID 169272336) has the molecular formula C35H34N8O7S3 and a molecular weight of 774.91 g/mol. Its IUPAC name is 6-[4-[4-(5-ethoxy-3-pyridinyl)thiophene-2-carbonyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide.
| Compound Name | 6-[4-[4-(5-ethoxy-3-pyridinyl)thiophene-2-carbonyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 169272336 |
| Molecular Formula | C35H34N8O7S3 |
| Molecular Weight | 774.91 g/mol |
| Exact Mass | 774.17 |
| IUPAC Name | 6-[4-[4-(5-ethoxy-3-pyridinyl)thiophene-2-carbonyl]piperazin-1-yl]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylpyridazine-3-carboxamide |
| SMILES | CCOc1cncc(-c2csc(C(=O)N3CCN(c4ccc(C(=O)NS(=O)(=O)c5ccc(NCCSc6ccccc6)c([N+](=O)[O-])c5)nn4)CC3)c2)c1 |
| InChI | InChI=1S/C35H34N8O7S3/c1-2-50-26-18-24(21-36-22-26)25-19-32(52-23-25)35(45)42-15-13-41(14-16-42)33-11-10-30(38-39-33)34(44)40-53(48,49)28-8-9-29(31(20-28)43(46)47)37-12-17-51-27-6-4-3-5-7-27/h3-11,18-23,37H,2,12-17H2,1H3,(H,40,44) |
| InChIKey | KAHYMJCUPHMNIS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 189.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.91 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|