C32H31N5O7S2 — CID 53235092
4-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide (PubChem CID 53235092) has the molecular formula C32H31N5O7S2 and a molecular weight of 661.76 g/mol. Its IUPAC name is 4-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide.
| Compound Name | 4-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 53235092 |
| Molecular Formula | C32H31N5O7S2 |
| Molecular Weight | 661.76 g/mol |
| Exact Mass | 661.17 |
| IUPAC Name | 4-[[(2S)-2-acetamido-3-phenylpropanoyl]amino]-N-[3-nitro-4-(2-phenylsulfanylethylamino)phenyl]sulfonylbenzamide |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc(C(=O)NS(=O)(=O)c2ccc(NCCSc3ccccc3)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C32H31N5O7S2/c1-22(38)34-29(20-23-8-4-2-5-9-23)32(40)35-25-14-12-24(13-15-25)31(39)36-46(43,44)27-16-17-28(30(21-27)37(41)42)33-18-19-45-26-10-6-3-7-11-26/h2-17,21,29,33H,18-20H2,1H3,(H,34,38)(H,35,40)(H,36,39)/t29-/m0/s1 |
| InChIKey | FYLZETVUGWJRIK-LJAQVGFWSA-N |
| XLogP | 4.60 |
| TPSA | 176.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.76 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|