C34H30N4O5S3 — CID 123989891
2-[4-[[(4-azidophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonyl-1-naphthalen-1-ylethanone;sulfur dioxide (PubChem CID 123989891) has the molecular formula C34H30N4O5S3 and a molecular weight of 670.84 g/mol. Its IUPAC name is 2-[4-[[(4-azidophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonyl-1-naphthalen-1-ylethanone;sulfur dioxide.
| Compound Name | 2-[4-[[(4-azidophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonyl-1-naphthalen-1-ylethanone;sulfur dioxide |
|---|---|
| PubChem CID | 123989891 |
| Molecular Formula | C34H30N4O5S3 |
| Molecular Weight | 670.84 g/mol |
| Exact Mass | 670.14 |
| IUPAC Name | 2-[4-[[(4-azidophenyl)methyl-(2-phenylsulfanylethyl)amino]methyl]phenyl]sulfonyl-1-naphthalen-1-ylethanone;sulfur dioxide |
| SMILES | O=S=O.[N-]=[N+]=Nc1ccc(CN(CCSc2ccccc2)Cc2ccc(S(=O)(=O)CC(=O)c3cccc4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C34H30N4O3S2.O2S/c35-37-36-29-17-13-26(14-18-29)23-38(21-22-42-30-9-2-1-3-10-30)24-27-15-19-31(20-16-27)43(40,41)25-34(39)33-12-6-8-28-7-4-5-11-32(28)33;1-3-2/h1-20H,21-25H2; |
| InChIKey | QJVVDMASVQIDNT-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 137.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.84 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|