C18H20N4O4S2 — CID 88578234
2-[1,3-benzodioxol-5-ylmethyl(2-phenylsulfanylethyl)amino]-N-diazoethanesulfonamide (PubChem CID 88578234) has the molecular formula C18H20N4O4S2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-ylmethyl(2-phenylsulfanylethyl)amino]-N-diazoethanesulfonamide.
| Compound Name | 2-[1,3-benzodioxol-5-ylmethyl(2-phenylsulfanylethyl)amino]-N-diazoethanesulfonamide |
|---|---|
| PubChem CID | 88578234 |
| Molecular Formula | C18H20N4O4S2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 2-[1,3-benzodioxol-5-ylmethyl(2-phenylsulfanylethyl)amino]-N-diazoethanesulfonamide |
| SMILES | [N-]=[N+]=NS(=O)(=O)CCN(CCSc1ccccc1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20N4O4S2/c19-20-21-28(23,24)11-9-22(8-10-27-16-4-2-1-3-5-16)13-15-6-7-17-18(12-15)26-14-25-17/h1-7,12H,8-11,13-14H2 |
| InChIKey | QQHZTGLQQUOQAH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 104.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|