C17H16O4S — CID 55315697
1,3-benzodioxol-5-ylmethyl 3-phenylsulfanylpropanoate (PubChem CID 55315697) has the molecular formula C17H16O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 3-phenylsulfanylpropanoate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl 3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 55315697 |
| Molecular Formula | C17H16O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl 3-phenylsulfanylpropanoate |
| SMILES | O=C(CCSc1ccccc1)OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16O4S/c18-17(8-9-22-14-4-2-1-3-5-14)19-11-13-6-7-15-16(10-13)21-12-20-15/h1-7,10H,8-9,11-12H2 |
| InChIKey | MHZDUJGFINFZEO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |