C16H13FO4S — CID 78762992
1,3-benzodioxol-5-ylmethyl 2-(4-fluorophenyl)sulfanylacetate (PubChem CID 78762992) has the molecular formula C16H13FO4S and a molecular weight of 320.34 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl 2-(4-fluorophenyl)sulfanylacetate.
| Compound Name | 1,3-benzodioxol-5-ylmethyl 2-(4-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 78762992 |
| Molecular Formula | C16H13FO4S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl 2-(4-fluorophenyl)sulfanylacetate |
| SMILES | O=C(CSc1ccc(F)cc1)OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13FO4S/c17-12-2-4-13(5-3-12)22-9-16(18)19-8-11-1-6-14-15(7-11)21-10-20-14/h1-7H,8-10H2 |
| InChIKey | OTCBDJBNXMVFEE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |