C26H24N2O3S2 — CID 56656245
N-(2-phenylsulfanylethyl)-N-[(4-sulfamoylphenyl)methyl]naphthalene-1-carboxamide (PubChem CID 56656245) has the molecular formula C26H24N2O3S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is N-(2-phenylsulfanylethyl)-N-[(4-sulfamoylphenyl)methyl]naphthalene-1-carboxamide.
| Compound Name | N-(2-phenylsulfanylethyl)-N-[(4-sulfamoylphenyl)methyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 56656245 |
| Molecular Formula | C26H24N2O3S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N-(2-phenylsulfanylethyl)-N-[(4-sulfamoylphenyl)methyl]naphthalene-1-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(CN(CCSc2ccccc2)C(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H24N2O3S2/c27-33(30,31)23-15-13-20(14-16-23)19-28(17-18-32-22-9-2-1-3-10-22)26(29)25-12-6-8-21-7-4-5-11-24(21)25/h1-16H,17-19H2,(H2,27,30,31) |
| InChIKey | CLLUQQWBMQHUDO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |