C27H21ClFN3O5S2 — CID 22730355
N-[4-[2-(4-chlorophenyl)sulfanylethylamino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide (PubChem CID 22730355) has the molecular formula C27H21ClFN3O5S2 and a molecular weight of 586.07 g/mol. Its IUPAC name is N-[4-[2-(4-chlorophenyl)sulfanylethylamino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide.
| Compound Name | N-[4-[2-(4-chlorophenyl)sulfanylethylamino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 22730355 |
| Molecular Formula | C27H21ClFN3O5S2 |
| Molecular Weight | 586.07 g/mol |
| Exact Mass | 585.06 |
| IUPAC Name | N-[4-[2-(4-chlorophenyl)sulfanylethylamino]-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCCSc2ccc(Cl)cc2)c([N+](=O)[O-])c1)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H21ClFN3O5S2/c28-21-7-11-23(12-8-21)38-16-15-30-25-14-13-24(17-26(25)32(34)35)39(36,37)31-27(33)20-3-1-18(2-4-20)19-5-9-22(29)10-6-19/h1-14,17,30H,15-16H2,(H,31,33) |
| InChIKey | ZQJMCXIRIDOGIO-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.07 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|