C28H30FN3O5S — CID 22730610
N-[4-(3-cyclohexylpropylamino)-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide (PubChem CID 22730610) has the molecular formula C28H30FN3O5S and a molecular weight of 539.63 g/mol. Its IUPAC name is N-[4-(3-cyclohexylpropylamino)-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide.
| Compound Name | N-[4-(3-cyclohexylpropylamino)-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 22730610 |
| Molecular Formula | C28H30FN3O5S |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | N-[4-(3-cyclohexylpropylamino)-3-nitrophenyl]sulfonyl-4-(4-fluorophenyl)benzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCCCC2CCCCC2)c([N+](=O)[O-])c1)c1ccc(-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H30FN3O5S/c29-24-14-12-22(13-15-24)21-8-10-23(11-9-21)28(33)31-38(36,37)25-16-17-26(27(19-25)32(34)35)30-18-4-7-20-5-2-1-3-6-20/h8-17,19-20,30H,1-7,18H2,(H,31,33) |
| InChIKey | OMGDKUSPFQUNSS-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|