C31H33FN4O5S — CID 22730781
N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonyl-4-[4-fluoro-2-(methylamino)phenyl]benzamide (PubChem CID 22730781) has the molecular formula C31H33FN4O5S and a molecular weight of 592.69 g/mol. Its IUPAC name is N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonyl-4-[4-fluoro-2-(methylamino)phenyl]benzamide.
| Compound Name | N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonyl-4-[4-fluoro-2-(methylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 22730781 |
| Molecular Formula | C31H33FN4O5S |
| Molecular Weight | 592.69 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonyl-4-[4-fluoro-2-(methylamino)phenyl]benzamide |
| SMILES | CNc1cc(F)ccc1-c1ccc(C(=O)NS(=O)(=O)c2ccc(NCC34CC5CC(CC(C5)C3)C4)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C31H33FN4O5S/c1-33-28-13-24(32)6-8-26(28)22-2-4-23(5-3-22)30(37)35-42(40,41)25-7-9-27(29(14-25)36(38)39)34-18-31-15-19-10-20(16-31)12-21(11-19)17-31/h2-9,13-14,19-21,33-34H,10-12,15-18H2,1H3,(H,35,37) |
| InChIKey | IIQQISBVXIDDHA-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.69 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|