C34H41N3O5S — CID 22730690
4-(3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)-N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonylbenzamide (PubChem CID 22730690) has the molecular formula C34H41N3O5S and a molecular weight of 603.79 g/mol. Its IUPAC name is 4-(3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)-N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonylbenzamide.
| Compound Name | 4-(3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)-N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 22730690 |
| Molecular Formula | C34H41N3O5S |
| Molecular Weight | 603.79 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | 4-(3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)-N-[4-(1-adamantylmethylamino)-3-nitrophenyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1ccc(NCC23CC4CC(CC(C4)C2)C3)c([N+](=O)[O-])c1)c1ccc(C2=CCCC3CCCCC23)cc1 |
| InChI | InChI=1S/C34H41N3O5S/c38-33(27-10-8-26(9-11-27)30-7-3-5-25-4-1-2-6-29(25)30)36-43(41,42)28-12-13-31(32(17-28)37(39)40)35-21-34-18-22-14-23(19-34)16-24(15-22)20-34/h7-13,17,22-25,29,35H,1-6,14-16,18-21H2,(H,36,38) |
| InChIKey | BCYPLQXLUIPKAJ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.79 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|