C17H24OS — CID 143046067
3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyprop-1-ene-2-thiol;(3Z)-2-methylhexa-1,3,5-triene (PubChem CID 143046067) has the molecular formula C17H24OS and a molecular weight of 276.45 g/mol. Its IUPAC name is 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyprop-1-ene-2-thiol;(3Z)-2-methylhexa-1,3,5-triene.
| Compound Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyprop-1-ene-2-thiol;(3Z)-2-methylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 143046067 |
| Molecular Formula | C17H24OS |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 3-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyprop-1-ene-2-thiol;(3Z)-2-methylhexa-1,3,5-triene |
| SMILES | C=C/C=C\C(=C)C.C=C/C=C\C(=C/C)OCC(=C)S |
| InChI | InChI=1S/C10H14OS.C7H10/c1-4-6-7-10(5-2)11-8-9(3)12;1-4-5-6-7(2)3/h4-7,12H,1,3,8H2,2H3;4-6H,1-2H2,3H3/b7-6-,10-5+;6-5- |
| InChIKey | OTMOEYRSLBXNBF-RUARHNMGSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|