C11H19NO2 — CID 154979177
2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethoxy]ethanamine (PubChem CID 154979177) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethoxy]ethanamine.
| Compound Name | 2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethoxy]ethanamine |
|---|---|
| PubChem CID | 154979177 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethoxy]ethanamine |
| SMILES | C=C/C=C\C(=C/C)OCCOCCN |
| InChI | InChI=1S/C11H19NO2/c1-3-5-6-11(4-2)14-10-9-13-8-7-12/h3-6H,1,7-10,12H2,2H3/b6-5-,11-4+ |
| InChIKey | GJSDMIQUMZKQRV-VWXLBWAMSA-N |
| XLogP | 1.62 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|