C14H22 — CID 162361818
(3Z,5Z)-5-ethylhepta-1,3,5-triene;2-methylbuta-1,3-diene (PubChem CID 162361818) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is (3Z,5Z)-5-ethylhepta-1,3,5-triene;2-methylbuta-1,3-diene.
| Compound Name | (3Z,5Z)-5-ethylhepta-1,3,5-triene;2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 162361818 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | (3Z,5Z)-5-ethylhepta-1,3,5-triene;2-methylbuta-1,3-diene |
| SMILES | C=C/C=C\C(=C/C)CC.C=CC(=C)C |
| InChI | InChI=1S/C9H14.C5H8/c1-4-7-8-9(5-2)6-3;1-4-5(2)3/h4-5,7-8H,1,6H2,2-3H3;4H,1-2H2,3H3/b8-7-,9-5-; |
| InChIKey | KMCOHMKFADMYIW-XXAYGNTESA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|