C10H14 — CID 142047079
(3Z,5Z)-4-ethylocta-1,3,5,7-tetraene (PubChem CID 142047079) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is (3Z,5Z)-4-ethylocta-1,3,5,7-tetraene.
| Compound Name | (3Z,5Z)-4-ethylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 142047079 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (3Z,5Z)-4-ethylocta-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C(=C/C=C)CC |
| InChI | InChI=1S/C10H14/c1-4-7-9-10(6-3)8-5-2/h4-5,7-9H,1-2,6H2,3H3/b9-7-,10-8- |
| InChIKey | AYJJLVUIKLDDDY-XOHWUJONSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|